C20H21F6N5O — CID 87578751
N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylacetohydrazide (PubChem CID 87578751) has the molecular formula C20H21F6N5O and a molecular weight of 461.41 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylacetohydrazide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 87578751 |
| Molecular Formula | C20H21F6N5O |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylacetohydrazide |
| SMILES | CN1CCN(C(C(=O)N(N)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccn2)CC1 |
| InChI | InChI=1S/C20H21F6N5O/c1-29-6-8-30(9-7-29)17(16-4-2-3-5-28-16)18(32)31(27)15-11-13(19(21,22)23)10-14(12-15)20(24,25)26/h2-5,10-12,17H,6-9,27H2,1H3 |
| InChIKey | DKIQRTUVWGTXGP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|