C21H23F5N4O — CID 70834580
N'-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)-2-(4-methylpiperazin-1-yl)acetohydrazide (PubChem CID 70834580) has the molecular formula C21H23F5N4O and a molecular weight of 442.43 g/mol. Its IUPAC name is N'-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)-2-(4-methylpiperazin-1-yl)acetohydrazide.
| Compound Name | N'-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)-2-(4-methylpiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 70834580 |
| Molecular Formula | C21H23F5N4O |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N'-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)-2-(4-methylpiperazin-1-yl)acetohydrazide |
| SMILES | CN1CCN(C(C(=O)NNc2cc(CF)cc(C(F)(F)F)c2)c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H23F5N4O/c1-29-6-8-30(9-7-29)19(17-4-2-3-5-18(17)23)20(31)28-27-16-11-14(13-22)10-15(12-16)21(24,25)26/h2-5,10-12,19,27H,6-9,13H2,1H3,(H,28,31) |
| InChIKey | VEYJFXGXPWUPFM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|