C21H17F4N2O2S+ — CID 118534006
N-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(1-hydroxypyridin-1-ium-2-yl)sulfanyl-2-phenylacetamide (PubChem CID 118534006) has the molecular formula C21H17F4N2O2S+ and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(1-hydroxypyridin-1-ium-2-yl)sulfanyl-2-phenylacetamide.
| Compound Name | N-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(1-hydroxypyridin-1-ium-2-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 118534006 |
| Molecular Formula | C21H17F4N2O2S+ |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-2-(1-hydroxypyridin-1-ium-2-yl)sulfanyl-2-phenylacetamide |
| SMILES | O=C(Nc1cc(CF)cc(C(F)(F)F)c1)C(Sc1cccc[n+]1O)c1ccccc1 |
| InChI | InChI=1S/C21H16F4N2O2S/c22-13-14-10-16(21(23,24)25)12-17(11-14)26-20(28)19(15-6-2-1-3-7-15)30-18-8-4-5-9-27(18)29/h1-12,19H,13H2,(H-,26,28,29)/p+1 |
| InChIKey | GOSQOSPBZDZITQ-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|