C23H24F6N4O3 — CID 59570439
2-(1,3-benzodioxol-5-yl)-N'-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)propanehydrazide (PubChem CID 59570439) has the molecular formula C23H24F6N4O3 and a molecular weight of 518.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N'-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)propanehydrazide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N'-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 59570439 |
| Molecular Formula | C23H24F6N4O3 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N'-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)propanehydrazide |
| SMILES | CN1CCN(C(C)(C(=O)NNc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H24F6N4O3/c1-21(33-7-5-32(2)6-8-33,14-3-4-18-19(12-14)36-13-35-18)20(34)31-30-17-10-15(22(24,25)26)9-16(11-17)23(27,28)29/h3-4,9-12,30H,5-8,13H2,1-2H3,(H,31,34) |
| InChIKey | GVZBKBCHOMNRCS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|