C20H22N2O7 — CID 68765513
2-ethoxy-3-N-(2-ethylphenyl)benzene-1,3-dicarboxamide;oxalic acid (PubChem CID 68765513) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-ethoxy-3-N-(2-ethylphenyl)benzene-1,3-dicarboxamide;oxalic acid.
| Compound Name | 2-ethoxy-3-N-(2-ethylphenyl)benzene-1,3-dicarboxamide;oxalic acid |
|---|---|
| PubChem CID | 68765513 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-ethoxy-3-N-(2-ethylphenyl)benzene-1,3-dicarboxamide;oxalic acid |
| SMILES | CCOc1c(C(N)=O)cccc1C(=O)Nc1ccccc1CC.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H20N2O3.C2H2O4/c1-3-12-8-5-6-11-15(12)20-18(22)14-10-7-9-13(17(19)21)16(14)23-4-2;3-1(4)2(5)6/h5-11H,3-4H2,1-2H3,(H2,19,21)(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | OWCOQIJELNKBBK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|