C24H25ClN4O2 — CID 68771401
2-[2-(4-chlorophenyl)propyl]-N-(3-imidazol-1-ylpropyl)-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 68771401) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)propyl]-N-(3-imidazol-1-ylpropyl)-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | 2-[2-(4-chlorophenyl)propyl]-N-(3-imidazol-1-ylpropyl)-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68771401 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[2-(4-chlorophenyl)propyl]-N-(3-imidazol-1-ylpropyl)-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | CC(CN1C(=O)c2ccccc2C1C(=O)NCCCn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-17(18-7-9-19(25)10-8-18)15-29-22(20-5-2-3-6-21(20)24(29)31)23(30)27-11-4-13-28-14-12-26-16-28/h2-3,5-10,12,14,16-17,22H,4,11,13,15H2,1H3,(H,27,30) |
| InChIKey | MBPZVKHXRCNUSC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|