C18H20ClNO4 — CID 68772592
3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide (PubChem CID 68772592) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide.
| Compound Name | 3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 68772592 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide |
| SMILES | COc1c(Cl)c(C=C(C)C(=O)NCCO)c(OC)c2ccccc12 |
| InChI | InChI=1S/C18H20ClNO4/c1-11(18(22)20-8-9-21)10-14-15(19)17(24-3)13-7-5-4-6-12(13)16(14)23-2/h4-7,10,21H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | BRMGJRLNTPAHDN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|