C17H11ClFN5O2 — CID 6877302
N-[(E)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 6877302) has the molecular formula C17H11ClFN5O2 and a molecular weight of 371.76 g/mol. Its IUPAC name is N-[(E)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6877302 |
| Molecular Formula | C17H11ClFN5O2 |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[(E)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Oc2nc(Cl)ncc2F)cc1)c1ccncc1 |
| InChI | InChI=1S/C17H11ClFN5O2/c18-17-21-10-14(19)16(23-17)26-13-3-1-11(2-4-13)9-22-24-15(25)12-5-7-20-8-6-12/h1-10H,(H,24,25)/b22-9+ |
| InChIKey | NUXCVCCIKHNLAQ-LSFURLLWSA-N |
| XLogP | 3.22 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|