C22H20F4N2O3 — CID 68774326
5-[[(2R,4R)-4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)pentylidene]amino]-1H-quinolin-2-one (PubChem CID 68774326) has the molecular formula C22H20F4N2O3 and a molecular weight of 436.41 g/mol. Its IUPAC name is 5-[[(2R,4R)-4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)pentylidene]amino]-1H-quinolin-2-one.
| Compound Name | 5-[[(2R,4R)-4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)pentylidene]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68774326 |
| Molecular Formula | C22H20F4N2O3 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[[(2R,4R)-4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)pentylidene]amino]-1H-quinolin-2-one |
| SMILES | COc1c(F)cccc1[C@H](C)C[C@@](O)(/C=N/c1cccc2[nH]c(=O)ccc12)C(F)(F)F |
| InChI | InChI=1S/C22H20F4N2O3/c1-13(14-5-3-6-16(23)20(14)31-2)11-21(30,22(24,25)26)12-27-17-7-4-8-18-15(17)9-10-19(29)28-18/h3-10,12-13,30H,11H2,1-2H3,(H,28,29)/b27-12+/t13-,21-/m1/s1 |
| InChIKey | CNNGTLLVSMKHCG-UEBXJQTLSA-N |
| XLogP | 4.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|