C17H18N2O3 — CID 68779596
(3S)-3-amino-6-(2-ethoxyphenyl)-1-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 68779596) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3S)-3-amino-6-(2-ethoxyphenyl)-1-hydroxy-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-6-(2-ethoxyphenyl)-1-hydroxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68779596 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (3S)-3-amino-6-(2-ethoxyphenyl)-1-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | CCOc1ccccc1-c1ccc2c(c1)C[C@H](N)C(=O)N2O |
| InChI | InChI=1S/C17H18N2O3/c1-2-22-16-6-4-3-5-13(16)11-7-8-15-12(9-11)10-14(18)17(20)19(15)21/h3-9,14,21H,2,10,18H2,1H3/t14-/m0/s1 |
| InChIKey | FFGRBJLHZFBRFX-AWEZNQCLSA-N |
| XLogP | 2.36 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|