C15H9Cl3F2 — CID 68781452
1,2-dichloro-4-[(Z)-3-chloro-2-(2,4-difluorophenyl)prop-1-enyl]benzene (PubChem CID 68781452) has the molecular formula C15H9Cl3F2 and a molecular weight of 333.59 g/mol. Its IUPAC name is 1,2-dichloro-4-[(Z)-3-chloro-2-(2,4-difluorophenyl)prop-1-enyl]benzene.
| Compound Name | 1,2-dichloro-4-[(Z)-3-chloro-2-(2,4-difluorophenyl)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 68781452 |
| Molecular Formula | C15H9Cl3F2 |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1,2-dichloro-4-[(Z)-3-chloro-2-(2,4-difluorophenyl)prop-1-enyl]benzene |
| SMILES | Fc1ccc(/C(=C/c2ccc(Cl)c(Cl)c2)CCl)c(F)c1 |
| InChI | InChI=1S/C15H9Cl3F2/c16-8-10(12-3-2-11(19)7-15(12)20)5-9-1-4-13(17)14(18)6-9/h1-7H,8H2/b10-5+ |
| InChIKey | KPKDLUAQSVPIPZ-BJMVGYQFSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|