C15H11ClF2O — CID 155704173
(E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)prop-2-en-1-ol (PubChem CID 155704173) has the molecular formula C15H11ClF2O and a molecular weight of 280.70 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 155704173 |
| Molecular Formula | C15H11ClF2O |
| Molecular Weight | 280.70 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)prop-2-en-1-ol |
| SMILES | OC/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11ClF2O/c16-12-3-1-10(2-4-12)7-11(9-19)14-6-5-13(17)8-15(14)18/h1-8,19H,9H2/b11-7- |
| InChIKey | YHCQACFFMUMVQZ-XFFZJAGNSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|