C24H17ClF2NOU- — CID 155704139
(E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)-N-[(E)-3-phenylprop-2-enyl]prop-2-enamide;uranium (PubChem CID 155704139) has the molecular formula C24H17ClF2NOU- and a molecular weight of 646.88 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)-N-[(E)-3-phenylprop-2-enyl]prop-2-enamide;uranium.
| Compound Name | (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)-N-[(E)-3-phenylprop-2-enyl]prop-2-enamide;uranium |
|---|---|
| PubChem CID | 155704139 |
| Molecular Formula | C24H17ClF2NOU- |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-(2,4-difluorophenyl)-N-[(E)-3-phenylprop-2-enyl]prop-2-enamide;uranium |
| SMILES | O=C(N[CH-]/C=C/c1ccccc1)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1F.[U] |
| InChI | InChI=1S/C24H17ClF2NO.U/c25-19-10-8-18(9-11-19)15-22(21-13-12-20(26)16-23(21)27)24(29)28-14-4-7-17-5-2-1-3-6-17;/h1-16H,(H,28,29);/q-1;/b7-4+,22-15+; |
| InChIKey | YIWSMMWUCFMIOD-WFFOLKHUSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|