C15H11ClF2 — CID 24762264
1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4-difluorobenzene (PubChem CID 24762264) has the molecular formula C15H11ClF2 and a molecular weight of 264.70 g/mol. Its IUPAC name is 1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4-difluorobenzene.
| Compound Name | 1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 24762264 |
| Molecular Formula | C15H11ClF2 |
| Molecular Weight | 264.70 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(C/C=C/c2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C15H11ClF2/c16-13-7-4-11(5-8-13)2-1-3-12-6-9-14(17)10-15(12)18/h1-2,4-10H,3H2/b2-1+ |
| InChIKey | RWOFSLOEQZOHPX-OWOJBTEDSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |