C15H11BrF2 — CID 24762261
1-[(E)-3-(4-bromophenyl)prop-2-enyl]-2,4-difluorobenzene (PubChem CID 24762261) has the molecular formula C15H11BrF2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 1-[(E)-3-(4-bromophenyl)prop-2-enyl]-2,4-difluorobenzene.
| Compound Name | 1-[(E)-3-(4-bromophenyl)prop-2-enyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 24762261 |
| Molecular Formula | C15H11BrF2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-[(E)-3-(4-bromophenyl)prop-2-enyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(C/C=C/c2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C15H11BrF2/c16-13-7-4-11(5-8-13)2-1-3-12-6-9-14(17)10-15(12)18/h1-2,4-10H,3H2/b2-1+ |
| InChIKey | JQUVRIIRBGETCM-OWOJBTEDSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |