About 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene
1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene (PubChem CID 68781778) has the molecular formula C15H10Cl2F2
and a molecular weight of 299.15 g/mol. Its IUPAC name is 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene |
| PubChem CID | 68781778 |
| Molecular Formula | C15H10Cl2F2 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(C(=Cc2ccccc2Cl)CCl)c(F)c1 |
| InChI | InChI=1S/C15H10Cl2F2/c16-9-11(7-10-3-1-2-4-14(10)17)13-6-5-12(18)8-15(13)19/h1-8H,9H2 |
| InChIKey | ZHRQKSTZPVSDQM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene?
The IUPAC name of 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene (CID 68781778) is 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene.
What is the SMILES notation for 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene?
The canonical SMILES for 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene is Fc1ccc(C(=Cc2ccccc2Cl)CCl)c(F)c1.
What is the InChIKey of 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene?
The InChIKey is ZHRQKSTZPVSDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2F2/c16-9-11(7-10-3-1-2-4-14(10)17)13-6-5-12(18)8-15(13)19/h1-8H,9H2.
What are the key properties of 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene?
1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene has a molecular weight of 299.15 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene is sourced from PubChem (CID 68781778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).