C41H42O10 — CID 68789393
1-[1-[4-[9-[4-[1-[1-(2-hydroxyprop-2-enoyloxy)propoxy]ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]propyl 2-hydroxyprop-2-enoate (PubChem CID 68789393) has the molecular formula C41H42O10 and a molecular weight of 694.78 g/mol. Its IUPAC name is 1-[1-[4-[9-[4-[1-[1-(2-hydroxyprop-2-enoyloxy)propoxy]ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]propyl 2-hydroxyprop-2-enoate.
| Compound Name | 1-[1-[4-[9-[4-[1-[1-(2-hydroxyprop-2-enoyloxy)propoxy]ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]propyl 2-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 68789393 |
| Molecular Formula | C41H42O10 |
| Molecular Weight | 694.78 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 1-[1-[4-[9-[4-[1-[1-(2-hydroxyprop-2-enoyloxy)propoxy]ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]propyl 2-hydroxyprop-2-enoate |
| SMILES | C=C(O)C(=O)OC(CC)OC(C)Oc1ccc(C2(c3ccc(OC(C)OC(CC)OC(=O)C(=C)O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C41H42O10/c1-7-37(50-39(44)25(3)42)48-27(5)46-31-21-17-29(18-22-31)41(35-15-11-9-13-33(35)34-14-10-12-16-36(34)41)30-19-23-32(24-20-30)47-28(6)49-38(8-2)51-40(45)26(4)43/h9-24,27-28,37-38,42-43H,3-4,7-8H2,1-2,5-6H3 |
| InChIKey | OBOOZJPZMJKXHT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.78 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|