C47H52F2O6 — CID 23527450
6-[4-[2-[9,9-difluoro-7-[2-[4-(1-prop-2-enoyloxyhexoxy)phenyl]ethyl]fluoren-2-yl]ethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 23527450) has the molecular formula C47H52F2O6 and a molecular weight of 750.92 g/mol. Its IUPAC name is 6-[4-[2-[9,9-difluoro-7-[2-[4-(1-prop-2-enoyloxyhexoxy)phenyl]ethyl]fluoren-2-yl]ethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[9,9-difluoro-7-[2-[4-(1-prop-2-enoyloxyhexoxy)phenyl]ethyl]fluoren-2-yl]ethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 23527450 |
| Molecular Formula | C47H52F2O6 |
| Molecular Weight | 750.92 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | 6-[4-[2-[9,9-difluoro-7-[2-[4-(1-prop-2-enoyloxyhexoxy)phenyl]ethyl]fluoren-2-yl]ethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCc2ccc3c(c2)C(F)(F)c2cc(CCc4ccc(OC(CCCCC)OC(=O)C=C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C47H52F2O6/c1-4-7-10-13-46(55-45(51)6-3)54-39-26-20-35(21-27-39)15-17-37-23-29-41-40-28-22-36(32-42(40)47(48,49)43(41)33-37)16-14-34-18-24-38(25-19-34)52-30-11-8-9-12-31-53-44(50)5-2/h5-6,18-29,32-33,46H,2-4,7-17,30-31H2,1H3 |
| InChIKey | NRWFNVPXGWGRNH-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.92 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|