C21H28ClN5O3S — CID 68792041
4-amino-3-N-butyl-3-N-(butylcarbamoyl)-5-N-[(2-chlorophenyl)methyl]-1,2-thiazole-3,5-dicarboxamide (PubChem CID 68792041) has the molecular formula C21H28ClN5O3S and a molecular weight of 466.01 g/mol. Its IUPAC name is 4-amino-3-N-butyl-3-N-(butylcarbamoyl)-5-N-[(2-chlorophenyl)methyl]-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-3-N-butyl-3-N-(butylcarbamoyl)-5-N-[(2-chlorophenyl)methyl]-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 68792041 |
| Molecular Formula | C21H28ClN5O3S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-amino-3-N-butyl-3-N-(butylcarbamoyl)-5-N-[(2-chlorophenyl)methyl]-1,2-thiazole-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)N(CCCC)C(=O)c1nsc(C(=O)NCc2ccccc2Cl)c1N |
| InChI | InChI=1S/C21H28ClN5O3S/c1-3-5-11-24-21(30)27(12-6-4-2)20(29)17-16(23)18(31-26-17)19(28)25-13-14-9-7-8-10-15(14)22/h7-10H,3-6,11-13,23H2,1-2H3,(H,24,30)(H,25,28) |
| InChIKey | WIQXACRRMUSIFJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|