C24H23NO4S — CID 68796262
[3-[(4-methylbenzoyl)-(3-methylbut-2-enyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68796262) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is [3-[(4-methylbenzoyl)-(3-methylbut-2-enyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
| Compound Name | [3-[(4-methylbenzoyl)-(3-methylbut-2-enyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68796262 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [3-[(4-methylbenzoyl)-(3-methylbut-2-enyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | CC(C)=CCN(C(=O)c1ccc(C)cc1)c1cc(-c2ccccc2)sc1OC(=O)O |
| InChI | InChI=1S/C24H23NO4S/c1-16(2)13-14-25(22(26)19-11-9-17(3)10-12-19)20-15-21(18-7-5-4-6-8-18)30-23(20)29-24(27)28/h4-13,15H,14H2,1-3H3,(H,27,28) |
| InChIKey | BUUJVBGNNJPRTG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|