C22H18N2O6S — CID 68799790
[3-[cyclopropanecarbonyl-[(4-nitrophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68799790) has the molecular formula C22H18N2O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is [3-[cyclopropanecarbonyl-[(4-nitrophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
| Compound Name | [3-[cyclopropanecarbonyl-[(4-nitrophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68799790 |
| Molecular Formula | C22H18N2O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [3-[cyclopropanecarbonyl-[(4-nitrophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1sc(-c2ccccc2)cc1N(Cc1ccc([N+](=O)[O-])cc1)C(=O)C1CC1 |
| InChI | InChI=1S/C22H18N2O6S/c25-20(16-8-9-16)23(13-14-6-10-17(11-7-14)24(28)29)18-12-19(15-4-2-1-3-5-15)31-21(18)30-22(26)27/h1-7,10-12,16H,8-9,13H2,(H,26,27) |
| InChIKey | RHKFZJAXKUYSOD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|