C18H19NO4S — CID 68799400
[3-[(2-cyclopentyl-2-oxoethyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68799400) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [3-[(2-cyclopentyl-2-oxoethyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
| Compound Name | [3-[(2-cyclopentyl-2-oxoethyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68799400 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [3-[(2-cyclopentyl-2-oxoethyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1sc(-c2ccccc2)cc1NCC(=O)C1CCCC1 |
| InChI | InChI=1S/C18H19NO4S/c20-15(12-6-4-5-7-12)11-19-14-10-16(13-8-2-1-3-9-13)24-17(14)23-18(21)22/h1-3,8-10,12,19H,4-7,11H2,(H,21,22) |
| InChIKey | WQYSVUKQTVGVEU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |