C20H17NO5S — CID 68800292
[5-(3-hydroxyphenyl)-3-[methyl-(4-methylbenzoyl)amino]thiophen-2-yl] hydrogen carbonate (PubChem CID 68800292) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is [5-(3-hydroxyphenyl)-3-[methyl-(4-methylbenzoyl)amino]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-(3-hydroxyphenyl)-3-[methyl-(4-methylbenzoyl)amino]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68800292 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [5-(3-hydroxyphenyl)-3-[methyl-(4-methylbenzoyl)amino]thiophen-2-yl] hydrogen carbonate |
| SMILES | Cc1ccc(C(=O)N(C)c2cc(-c3cccc(O)c3)sc2OC(=O)O)cc1 |
| InChI | InChI=1S/C20H17NO5S/c1-12-6-8-13(9-7-12)18(23)21(2)16-11-17(27-19(16)26-20(24)25)14-4-3-5-15(22)10-14/h3-11,22H,1-2H3,(H,24,25) |
| InChIKey | WVOMJVTXUNWMSH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |