C21H28N2O6S — CID 68800101
1-ethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]ethoxy]-4-oxoquinoline-3-carboxylic acid (PubChem CID 68800101) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-ethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]ethoxy]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]ethoxy]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 68800101 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-ethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]ethoxy]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(OCCSCCNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C21H28N2O6S/c1-5-23-13-16(19(25)26)18(24)15-12-14(6-7-17(15)23)28-9-11-30-10-8-22-20(27)29-21(2,3)4/h6-7,12-13H,5,8-11H2,1-4H3,(H,22,27)(H,25,26) |
| InChIKey | YUNIMASPGJCKAV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|