C27H23N5O4S2 — CID 6880247
N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 6880247) has the molecular formula C27H23N5O4S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6880247 |
| Molecular Formula | C27H23N5O4S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3)N/N=C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H23N5O4S2/c33-23(30-28-16-8-10-18-9-4-6-14-21(18)32(35)36)17-37-27-29-25-24(20-13-5-7-15-22(20)38-25)26(34)31(27)19-11-2-1-3-12-19/h1-4,6,8-12,14,16H,5,7,13,15,17H2,(H,30,33)/b10-8+,28-16+ |
| InChIKey | WBZHUJWKKAWOHT-POGUPQBGSA-N |
| XLogP | 5.14 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|