C23H23N3O3 — CID 68803098
2-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)pyrrolidine-1-carboxylic acid (PubChem CID 68803098) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68803098 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C23H23N3O3/c27-22(28)26-14-6-11-20(26)21(17-7-2-1-3-8-17)23(29,18-9-4-12-24-15-18)19-10-5-13-25-16-19/h1-5,7-10,12-13,15-16,20-21,29H,6,11,14H2,(H,27,28) |
| InChIKey | JXDRZVXCCVNRIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |