C26H28N4O4 — CID 68804170
(E)-but-2-enedioic acid;N-[5-(1H-indol-4-yl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine (PubChem CID 68804170) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[5-(1H-indol-4-yl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[5-(1H-indol-4-yl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine |
|---|---|
| PubChem CID | 68804170 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[5-(1H-indol-4-yl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| SMILES | O=C(O)/C=C/C(=O)O.c1cc(-c2cncc(NC3C4CC5CC3CN(C5)C4)c2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C22H24N4.C4H4O4/c1-2-19(20-4-5-24-21(20)3-1)15-8-18(10-23-9-15)25-22-16-6-14-7-17(22)13-26(11-14)12-16;5-3(6)1-2-4(7)8/h1-5,8-10,14,16-17,22,24-25H,6-7,11-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HUNRQBAJNJNWGN-WLHGVMLRSA-N |
| XLogP | 3.69 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|