C21H23N5O4 — CID 68806763
6-N-[(2,4-dimethoxyphenyl)methyl]-3-nitro-2-N-(2-pyridin-3-ylethyl)pyridine-2,6-diamine (PubChem CID 68806763) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 6-N-[(2,4-dimethoxyphenyl)methyl]-3-nitro-2-N-(2-pyridin-3-ylethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-[(2,4-dimethoxyphenyl)methyl]-3-nitro-2-N-(2-pyridin-3-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 68806763 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 6-N-[(2,4-dimethoxyphenyl)methyl]-3-nitro-2-N-(2-pyridin-3-ylethyl)pyridine-2,6-diamine |
| SMILES | COc1ccc(CNc2ccc([N+](=O)[O-])c(NCCc3cccnc3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H23N5O4/c1-29-17-6-5-16(19(12-17)30-2)14-24-20-8-7-18(26(27)28)21(25-20)23-11-9-15-4-3-10-22-13-15/h3-8,10,12-13H,9,11,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZKBCPQJULWITEG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|