C27H19FN2O2 — CID 68808001
3-fluoro-N-[3-(1-oxo-7-phenyl-2,3-dihydroisoindol-4-yl)phenyl]benzamide (PubChem CID 68808001) has the molecular formula C27H19FN2O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-fluoro-N-[3-(1-oxo-7-phenyl-2,3-dihydroisoindol-4-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[3-(1-oxo-7-phenyl-2,3-dihydroisoindol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 68808001 |
| Molecular Formula | C27H19FN2O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-fluoro-N-[3-(1-oxo-7-phenyl-2,3-dihydroisoindol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(-c3ccccc3)c3c2CNC3=O)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H19FN2O2/c28-20-10-4-9-19(14-20)26(31)30-21-11-5-8-18(15-21)22-12-13-23(17-6-2-1-3-7-17)25-24(22)16-29-27(25)32/h1-15H,16H2,(H,29,32)(H,30,31) |
| InChIKey | YMBWJZZIBNIGGV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |