C34H37N3O7S2 — CID 68808078
2-[[2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid (PubChem CID 68808078) has the molecular formula C34H37N3O7S2 and a molecular weight of 663.82 g/mol. Its IUPAC name is 2-[[2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 68808078 |
| Molecular Formula | C34H37N3O7S2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 2-[[2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid |
| SMILES | CCCCC1(CC)C(=O)Sc2cc(OCC(=O)NC(C(=O)NCC(=O)O)c3ccccc3)c(SC)cc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C34H37N3O7S2/c1-4-6-17-34(5-2)32(42)37(23-15-11-8-12-16-23)24-18-27(45-3)25(19-26(24)46-33(34)43)44-21-28(38)36-30(22-13-9-7-10-14-22)31(41)35-20-29(39)40/h7-16,18-19,30H,4-6,17,20-21H2,1-3H3,(H,35,41)(H,36,38)(H,39,40) |
| InChIKey | SULXCXKTNGIWQF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|