C34H39N3O8S3 — CID 87710074
2-[[(2R)-2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid (PubChem CID 87710074) has the molecular formula C34H39N3O8S3 and a molecular weight of 713.90 g/mol. Its IUPAC name is 2-[[(2R)-2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2R)-2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87710074 |
| Molecular Formula | C34H39N3O8S3 |
| Molecular Weight | 713.90 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | 2-[[(2R)-2-[[2-[(3-butyl-3-ethyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid |
| SMILES | CCCCC1(CC)C(=O)Sc2cc(OCC(=O)N[C@@H](C(=O)NCCS(=O)(=O)O)c3ccccc3)c(SC)cc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C34H39N3O8S3/c1-4-6-17-34(5-2)32(40)37(24-15-11-8-12-16-24)25-20-28(46-3)26(21-27(25)47-33(34)41)45-22-29(38)36-30(23-13-9-7-10-14-23)31(39)35-18-19-48(42,43)44/h7-16,20-21,30H,4-6,17-19,22H2,1-3H3,(H,35,39)(H,36,38)(H,42,43,44)/t30-,34?/m1/s1 |
| InChIKey | WYUYUFOVXQMWIL-AMLLJQFGSA-N |
| XLogP | 5.53 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|