C37H43N3O8S2 — CID 69109031
(2R)-2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]-3-hydroxypropanoic acid (PubChem CID 69109031) has the molecular formula C37H43N3O8S2 and a molecular weight of 721.90 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 69109031 |
| Molecular Formula | C37H43N3O8S2 |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.25 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-2,4-dioxo-5-phenyl-1,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCCCC1(CCCC)C(=O)Sc2cc(OCC(=O)N[C@@H](C(=O)N[C@H](CO)C(=O)O)c3ccccc3)c(SC)cc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C37H43N3O8S2/c1-4-6-18-37(19-7-5-2)35(46)40(25-16-12-9-13-17-25)27-20-30(49-3)28(21-29(27)50-36(37)47)48-23-31(42)39-32(24-14-10-8-11-15-24)33(43)38-26(22-41)34(44)45/h8-17,20-21,26,32,41H,4-7,18-19,22-23H2,1-3H3,(H,38,43)(H,39,42)(H,44,45)/t26-,32-/m1/s1 |
| InChIKey | OVXQZJXWJUAPDM-HVIPQOSHSA-N |
| XLogP | 5.87 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|