C16H15BrN4O3 — CID 6880817
N-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide (PubChem CID 6880817) has the molecular formula C16H15BrN4O3 and a molecular weight of 391.23 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6880817 |
| Molecular Formula | C16H15BrN4O3 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(Br)cc1/C=N/NC(=O)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H15BrN4O3/c1-24-14-5-4-13(17)7-12(14)9-20-21-15(22)10-19-16(23)11-3-2-6-18-8-11/h2-9H,10H2,1H3,(H,19,23)(H,21,22)/b20-9+ |
| InChIKey | VNUTXXMMIMPVFT-AWQFTUOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|