C25H27NO5 — CID 68808927
tert-butyl 2-[(1-hydroxy-4,8-dimethyl-3-oxo-7-phenyl-4H-naphthalene-2-carbonyl)amino]acetate (PubChem CID 68808927) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is tert-butyl 2-[(1-hydroxy-4,8-dimethyl-3-oxo-7-phenyl-4H-naphthalene-2-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(1-hydroxy-4,8-dimethyl-3-oxo-7-phenyl-4H-naphthalene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 68808927 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl 2-[(1-hydroxy-4,8-dimethyl-3-oxo-7-phenyl-4H-naphthalene-2-carbonyl)amino]acetate |
| SMILES | Cc1c(-c2ccccc2)ccc2c1C(O)=C(C(=O)NCC(=O)OC(C)(C)C)C(=O)C2C |
| InChI | InChI=1S/C25H27NO5/c1-14-17(16-9-7-6-8-10-16)11-12-18-15(2)22(28)21(23(29)20(14)18)24(30)26-13-19(27)31-25(3,4)5/h6-12,15,29H,13H2,1-5H3,(H,26,30) |
| InChIKey | VZZYQFTZHADEJR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|