C36H42N4O4 — CID 68810099
tert-butyl 2-[6-[(4-ethoxyanilino)methyl]-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate (PubChem CID 68810099) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is tert-butyl 2-[6-[(4-ethoxyanilino)methyl]-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-[6-[(4-ethoxyanilino)methyl]-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 68810099 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | tert-butyl 2-[6-[(4-ethoxyanilino)methyl]-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
| SMILES | CCOc1ccc(NCc2cc3c(c(-c4cc5cc(CN6CCCCC6)ccc5n4C(=O)OC(C)(C)C)c2)C(=O)NC3)cc1 |
| InChI | InChI=1S/C36H42N4O4/c1-5-43-29-12-10-28(11-13-29)37-21-25-18-27-22-38-34(41)33(27)30(19-25)32-20-26-17-24(23-39-15-7-6-8-16-39)9-14-31(26)40(32)35(42)44-36(2,3)4/h9-14,17-20,37H,5-8,15-16,21-23H2,1-4H3,(H,38,41) |
| InChIKey | WPMNQPZGSKYPNY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|