2,4-dichloro-5-fluorobenzoic acid

C7H3Cl2FO2 — CID 688138

IUPAC2,4-dichloro-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C7H3Cl2FO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H,11,12)
InChIKeyKZCWJHUTTSVCRO-UHFFFAOYSA-N
MW209.00 g/mol
LogP2.83
Rot. Bonds1

About 2,4-dichloro-5-fluorobenzoic acid

2,4-dichloro-5-fluorobenzoic acid (PubChem CID 688138) has the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. Its IUPAC name is 2,4-dichloro-5-fluorobenzoic acid.

Molecular Properties

Compound Name2,4-dichloro-5-fluorobenzoic acid
PubChem CID688138
Molecular FormulaC7H3Cl2FO2
Molecular Weight209.00 g/mol
Exact Mass207.95
IUPAC Name2,4-dichloro-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C7H3Cl2FO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H,11,12)
InChIKeyKZCWJHUTTSVCRO-UHFFFAOYSA-N
XLogP2.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.00
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2,4-dichloro-5-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-5-fluorobenzoic acid?
The IUPAC name of 2,4-dichloro-5-fluorobenzoic acid (CID 688138) is 2,4-dichloro-5-fluorobenzoic acid.
What is the SMILES notation for 2,4-dichloro-5-fluorobenzoic acid?
The canonical SMILES for 2,4-dichloro-5-fluorobenzoic acid is O=C(O)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-5-fluorobenzoic acid?
The InChIKey is KZCWJHUTTSVCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2FO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H,11,12).
What are the key properties of 2,4-dichloro-5-fluorobenzoic acid?
2,4-dichloro-5-fluorobenzoic acid has a molecular weight of 209.00 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-fluorobenzoic acid is sourced from PubChem (CID 688138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).