C26H33FN2O3 — CID 68815866
tert-butyl N-[1-[4-(4-fluorobenzoyl)piperidin-1-yl]-3-phenylpropan-2-yl]carbamate (PubChem CID 68815866) has the molecular formula C26H33FN2O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-fluorobenzoyl)piperidin-1-yl]-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(4-fluorobenzoyl)piperidin-1-yl]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68815866 |
| Molecular Formula | C26H33FN2O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | tert-butyl N-[1-[4-(4-fluorobenzoyl)piperidin-1-yl]-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)CN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H33FN2O3/c1-26(2,3)32-25(31)28-23(17-19-7-5-4-6-8-19)18-29-15-13-21(14-16-29)24(30)20-9-11-22(27)12-10-20/h4-12,21,23H,13-18H2,1-3H3,(H,28,31) |
| InChIKey | YQWXPYPDRDQADV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |