C29H42F2N2O6 — CID 68817555
tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3,3-dimethyl-2-oxobutoxy)pyrrolidine-1-carboxylate (PubChem CID 68817555) has the molecular formula C29H42F2N2O6 and a molecular weight of 552.66 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3,3-dimethyl-2-oxobutoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3,3-dimethyl-2-oxobutoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68817555 |
| Molecular Formula | C29H42F2N2O6 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3,3-dimethyl-2-oxobutoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)N1[C@@H](Cc2cc(F)cc(F)c2)[C@@H]([C@H]2C[C@@H](OCC(=O)C(C)(C)C)CN2C(=O)OC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C29H42F2N2O6/c1-17(34)33-23(12-18-10-19(30)13-20(31)11-18)25(38-29(33,8)9)22-14-21(37-16-24(35)27(2,3)4)15-32(22)26(36)39-28(5,6)7/h10-11,13,21-23,25H,12,14-16H2,1-9H3/t21-,22-,23+,25-/m1/s1 |
| InChIKey | NDPWAQWREWVOFV-AGDMDRQQSA-N |
| XLogP | 4.87 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |