C24H34F2N2O5 — CID 86615389
tert-butyl (2R,5R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-5-hydroxypiperidine-1-carboxylate (PubChem CID 86615389) has the molecular formula C24H34F2N2O5 and a molecular weight of 468.54 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-5-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-5-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86615389 |
| Molecular Formula | C24H34F2N2O5 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | tert-butyl (2R,5R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-5-hydroxypiperidine-1-carboxylate |
| SMILES | CC(=O)N1[C@@H](Cc2cc(F)cc(F)c2)[C@@H]([C@H]2CC[C@@H](O)CN2C(=O)OC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C24H34F2N2O5/c1-14(29)28-20(11-15-9-16(25)12-17(26)10-15)21(32-24(28,5)6)19-8-7-18(30)13-27(19)22(31)33-23(2,3)4/h9-10,12,18-21,30H,7-8,11,13H2,1-6H3/t18-,19-,20+,21-/m1/s1 |
| InChIKey | COVWJCHHGVUUJT-MXEMCNAFSA-N |
| XLogP | 3.62 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |