C34H46F2N2O5 — CID 68814974
tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-[3-(3-methylbutyl)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 68814974) has the molecular formula C34H46F2N2O5 and a molecular weight of 600.75 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-[3-(3-methylbutyl)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-[3-(3-methylbutyl)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68814974 |
| Molecular Formula | C34H46F2N2O5 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-[3-(3-methylbutyl)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)N1[C@@H](Cc2cc(F)cc(F)c2)[C@@H]([C@H]2C[C@@H](Oc3cccc(CCC(C)C)c3)CN2C(=O)OC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C34H46F2N2O5/c1-21(2)12-13-23-10-9-11-27(16-23)41-28-19-29(37(20-28)32(40)43-33(4,5)6)31-30(38(22(3)39)34(7,8)42-31)17-24-14-25(35)18-26(36)15-24/h9-11,14-16,18,21,28-31H,12-13,17,19-20H2,1-8H3/t28-,29-,30+,31-/m1/s1 |
| InChIKey | MEXXBXZTRWAIMV-LTXXGDHTSA-N |
| XLogP | 6.90 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |