C30H31ClN2O — CID 68819131
N-[4-(4-chlorophenyl)phenyl]-3-[4-[(2-cyclohexylethylamino)methyl]phenyl]prop-2-ynamide (PubChem CID 68819131) has the molecular formula C30H31ClN2O and a molecular weight of 471.04 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)phenyl]-3-[4-[(2-cyclohexylethylamino)methyl]phenyl]prop-2-ynamide.
| Compound Name | N-[4-(4-chlorophenyl)phenyl]-3-[4-[(2-cyclohexylethylamino)methyl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 68819131 |
| Molecular Formula | C30H31ClN2O |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-[4-(4-chlorophenyl)phenyl]-3-[4-[(2-cyclohexylethylamino)methyl]phenyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc(CNCCC2CCCCC2)cc1)Nc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H31ClN2O/c31-28-15-11-26(12-16-28)27-13-17-29(18-14-27)33-30(34)19-10-24-6-8-25(9-7-24)22-32-21-20-23-4-2-1-3-5-23/h6-9,11-18,23,32H,1-5,20-22H2,(H,33,34) |
| InChIKey | UFCRDZMYEGQPDR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|