C23H29N3O3S — CID 68822276
3-[amino(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)methyl]-N-cyclohexylbenzamide (PubChem CID 68822276) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-[amino(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)methyl]-N-cyclohexylbenzamide.
| Compound Name | 3-[amino(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)methyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 68822276 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[amino(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)methyl]-N-cyclohexylbenzamide |
| SMILES | NC(c1cccc(C(=O)NC2CCCCC2)c1)S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H29N3O3S/c24-22(30(28,29)26-14-13-17-7-4-5-8-20(17)16-26)18-9-6-10-19(15-18)23(27)25-21-11-2-1-3-12-21/h4-10,15,21-22H,1-3,11-14,16,24H2,(H,25,27) |
| InChIKey | VVXXRESERJDOBC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |