C27H27N3O3S — CID 68826108
3-[[[4-(4-cyanophenyl)phenyl]sulfonylamino]methyl]-N-cyclohexylbenzamide (PubChem CID 68826108) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-[[[4-(4-cyanophenyl)phenyl]sulfonylamino]methyl]-N-cyclohexylbenzamide.
| Compound Name | 3-[[[4-(4-cyanophenyl)phenyl]sulfonylamino]methyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 68826108 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 3-[[[4-(4-cyanophenyl)phenyl]sulfonylamino]methyl]-N-cyclohexylbenzamide |
| SMILES | N#Cc1ccc(-c2ccc(S(=O)(=O)NCc3cccc(C(=O)NC4CCCCC4)c3)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c28-18-20-9-11-22(12-10-20)23-13-15-26(16-14-23)34(32,33)29-19-21-5-4-6-24(17-21)27(31)30-25-7-2-1-3-8-25/h4-6,9-17,25,29H,1-3,7-8,19H2,(H,30,31) |
| InChIKey | FZFUWJAYDBLRGZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |