C22H24N2O3S2 — CID 68821870
3-[(1-benzothiophen-2-ylsulfonylamino)methyl]-N-cyclohexylbenzamide (PubChem CID 68821870) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[(1-benzothiophen-2-ylsulfonylamino)methyl]-N-cyclohexylbenzamide.
| Compound Name | 3-[(1-benzothiophen-2-ylsulfonylamino)methyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 68821870 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-[(1-benzothiophen-2-ylsulfonylamino)methyl]-N-cyclohexylbenzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(CNS(=O)(=O)c2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H24N2O3S2/c25-22(24-19-10-2-1-3-11-19)18-9-6-7-16(13-18)15-23-29(26,27)21-14-17-8-4-5-12-20(17)28-21/h4-9,12-14,19,23H,1-3,10-11,15H2,(H,24,25) |
| InChIKey | MEWPWZIQHDIAPZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |