C20H23NO6 — CID 68831464
triethyl 3-cyano-2-methyl-1-phenylprop-2-ene-1,1,3-tricarboxylate (PubChem CID 68831464) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is triethyl 3-cyano-2-methyl-1-phenylprop-2-ene-1,1,3-tricarboxylate.
| Compound Name | triethyl 3-cyano-2-methyl-1-phenylprop-2-ene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 68831464 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | triethyl 3-cyano-2-methyl-1-phenylprop-2-ene-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(C#N)=C(C)C(C(=O)OCC)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C20H23NO6/c1-5-25-17(22)16(13-21)14(4)20(18(23)26-6-2,19(24)27-7-3)15-11-9-8-10-12-15/h8-12H,5-7H2,1-4H3 |
| InChIKey | YIOFQJAQPJZISX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|