C15H16ClF3N2OS — CID 68835223
1-[3-ethyl-4-methyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone;hydrochloride (PubChem CID 68835223) has the molecular formula C15H16ClF3N2OS and a molecular weight of 364.82 g/mol. Its IUPAC name is 1-[3-ethyl-4-methyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone;hydrochloride.
| Compound Name | 1-[3-ethyl-4-methyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 68835223 |
| Molecular Formula | C15H16ClF3N2OS |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[3-ethyl-4-methyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone;hydrochloride |
| SMILES | CCn1c(C)c(C(C)=O)s/c1=N\c1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C15H15F3N2OS.ClH/c1-4-20-9(2)13(10(3)21)22-14(20)19-12-7-5-11(6-8-12)15(16,17)18;/h5-8H,4H2,1-3H3;1H/b19-14-; |
| InChIKey | YVGILBYMILJESN-YEBWQKSTSA-N |
| XLogP | 4.75 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|