C14H9F3O5S — CID 68835812
3-(carboxymethoxy)-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid (PubChem CID 68835812) has the molecular formula C14H9F3O5S and a molecular weight of 346.28 g/mol. Its IUPAC name is 3-(carboxymethoxy)-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68835812 |
| Molecular Formula | C14H9F3O5S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-(carboxymethoxy)-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(-c2cccc(C(F)(F)F)c2)csc1C(=O)O |
| InChI | InChI=1S/C14H9F3O5S/c15-14(16,17)8-3-1-2-7(4-8)9-6-23-12(13(20)21)11(9)22-5-10(18)19/h1-4,6H,5H2,(H,18,19)(H,20,21) |
| InChIKey | MYYYEJXHAGUZFA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |