C25H22FN3O2 — CID 68836321
2-anilino-3-ethyl-5-(3-fluoro-4-phenylmethoxyphenyl)pyrimidin-4-one (PubChem CID 68836321) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-anilino-3-ethyl-5-(3-fluoro-4-phenylmethoxyphenyl)pyrimidin-4-one.
| Compound Name | 2-anilino-3-ethyl-5-(3-fluoro-4-phenylmethoxyphenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 68836321 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-anilino-3-ethyl-5-(3-fluoro-4-phenylmethoxyphenyl)pyrimidin-4-one |
| SMILES | CCn1c(Nc2ccccc2)ncc(-c2ccc(OCc3ccccc3)c(F)c2)c1=O |
| InChI | InChI=1S/C25H22FN3O2/c1-2-29-24(30)21(16-27-25(29)28-20-11-7-4-8-12-20)19-13-14-23(22(26)15-19)31-17-18-9-5-3-6-10-18/h3-16H,2,17H2,1H3,(H,27,28) |
| InChIKey | OZGGWWOXTWCGIB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |