C21H22BrN5O4S — CID 6883762
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[3-bromo-5-methoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 6883762) has the molecular formula C21H22BrN5O4S and a molecular weight of 520.41 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[3-bromo-5-methoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[3-bromo-5-methoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6883762 |
| Molecular Formula | C21H22BrN5O4S |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[3-bromo-5-methoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2nnc(N)s2)cc(Br)c1OCCOc1ccccc1C |
| InChI | InChI=1S/C21H22BrN5O4S/c1-13-5-3-4-6-16(13)30-7-8-31-20-15(22)9-14(10-17(20)29-2)12-24-25-18(28)11-19-26-27-21(23)32-19/h3-6,9-10,12H,7-8,11H2,1-2H3,(H2,23,27)(H,25,28)/b24-12+ |
| InChIKey | YGIYCGMLNOBUPH-WYMPLXKRSA-N |
| XLogP | 3.35 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|