C23H25Cl2N5O3S — CID 6881785
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]acetamide (PubChem CID 6881785) has the molecular formula C23H25Cl2N5O3S and a molecular weight of 522.46 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6881785 |
| Molecular Formula | C23H25Cl2N5O3S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCCOc2c(Cl)cc(/C=N/NC(=O)Cc3nnc(N)s3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H25Cl2N5O3S/c1-23(2,3)15-4-6-16(7-5-15)32-8-9-33-21-17(24)10-14(11-18(21)25)13-27-28-19(31)12-20-29-30-22(26)34-20/h4-7,10-11,13H,8-9,12H2,1-3H3,(H2,26,30)(H,28,31)/b27-13+ |
| InChIKey | SXQFYRGQOUMNKE-UVHMKAGCSA-N |
| XLogP | 4.88 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|